About 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol
3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol (PubChem CID 3406279) has the molecular formula C18H14Cl2F3N3O
and a molecular weight of 416.23 g/mol. Its IUPAC name is 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol.
Molecular Properties
| Compound Name | 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol |
| PubChem CID | 3406279 |
| Molecular Formula | C18H14Cl2F3N3O |
| Molecular Weight | 416.23 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol |
| SMILES | CC(C)n1c(O)c(/N=N/c2c(Cl)cc(C(F)(F)F)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C18H14Cl2F3N3O/c1-9(2)26-14-6-4-3-5-11(14)15(17(26)27)24-25-16-12(19)7-10(8-13(16)20)18(21,22)23/h3-9,27H,1-2H3/b25-24+ |
| InChIKey | YFAYJTOEMHCZFC-OCOZRVBESA-N |
| XLogP | 7.67 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.23 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol?
The IUPAC name of 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol (CID 3406279) is 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol.
What is the SMILES notation for 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol?
The canonical SMILES for 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol is CC(C)n1c(O)c(/N=N/c2c(Cl)cc(C(F)(F)F)cc2Cl)c2ccccc21.
What is the InChIKey of 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol?
The InChIKey is YFAYJTOEMHCZFC-OCOZRVBESA-N. The full InChI is InChI=1S/C18H14Cl2F3N3O/c1-9(2)26-14-6-4-3-5-11(14)15(17(26)27)24-25-16-12(19)7-10(8-13(16)20)18(21,22)23/h3-9,27H,1-2H3/b25-24+.
What are the key properties of 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol?
3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol has a molecular weight of 416.23 g/mol, XLogP of 7.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]-1-propan-2-ylindol-2-ol is sourced from PubChem (CID 3406279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).