C14H11F2N3O3 — CID 34067149
4-(difluoromethoxy)-N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]aniline (PubChem CID 34067149) has the molecular formula C14H11F2N3O3 and a molecular weight of 307.26 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]aniline.
| Compound Name | 4-(difluoromethoxy)-N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 34067149 |
| Molecular Formula | C14H11F2N3O3 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 4-(difluoromethoxy)-N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
| SMILES | FC(F)Oc1ccc(NCc2nc(-c3ccco3)no2)cc1 |
| InChI | InChI=1S/C14H11F2N3O3/c15-14(16)21-10-5-3-9(4-6-10)17-8-12-18-13(19-22-12)11-2-1-7-20-11/h1-7,14,17H,8H2 |
| InChIKey | AOEMYCPHFNCFGD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|