C16H8Cl2N4O2S2 — CID 3407264
5-amino-6-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-thiophen-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3407264) has the molecular formula C16H8Cl2N4O2S2 and a molecular weight of 423.31 g/mol. Its IUPAC name is 5-amino-6-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-thiophen-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-amino-6-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-thiophen-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3407264 |
| Molecular Formula | C16H8Cl2N4O2S2 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | 5-amino-6-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-thiophen-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | Nc1c(C=C2C=C(Cl)C(=O)C(Cl)=C2)c(=O)nc2sc(-c3cccs3)nn12 |
| InChI | InChI=1S/C16H8Cl2N4O2S2/c17-9-5-7(6-10(18)12(9)23)4-8-13(19)22-16(20-14(8)24)26-15(21-22)11-2-1-3-25-11/h1-6H,19H2 |
| InChIKey | MMVCZAIOTXEPGC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'} |
|---|