About (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene
(3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 3407865) has the molecular formula C29H20N2
and a molecular weight of 396.49 g/mol. Its IUPAC name is (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene.
Molecular Properties
| Compound Name | (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene |
| PubChem CID | 3407865 |
| Molecular Formula | C29H20N2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | [N-]=[N+]=C1C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C29H20N2/c30-31-29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(29)24-19-11-4-12-20-24/h1-20H |
| InChIKey | SEJXSFJDBRQEJY-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene?
The IUPAC name of (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene (CID 3407865) is (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene.
What is the SMILES notation for (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene?
The canonical SMILES for (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene is [N-]=[N+]=C1C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1.
What is the InChIKey of (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene?
The InChIKey is SEJXSFJDBRQEJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H20N2/c30-31-29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(29)24-19-11-4-12-20-24/h1-20H.
What are the key properties of (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene?
(3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene has a molecular weight of 396.49 g/mol, XLogP of 6.89, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-diazo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)benzene is sourced from PubChem (CID 3407865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).