C10H22O5 — CID 34085051
(2S,3R,4R)-2,3,4,5-tetramethylhexane-1,2,3,4,5-pentol (PubChem CID 34085051) has the molecular formula C10H22O5 and a molecular weight of 222.28 g/mol. Its IUPAC name is (2S,3R,4R)-2,3,4,5-tetramethylhexane-1,2,3,4,5-pentol.
| Compound Name | (2S,3R,4R)-2,3,4,5-tetramethylhexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 34085051 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (2S,3R,4R)-2,3,4,5-tetramethylhexane-1,2,3,4,5-pentol |
| SMILES | CC(C)(O)[C@@](C)(O)[C@](C)(O)[C@@](C)(O)CO |
| InChI | InChI=1S/C10H22O5/c1-7(2,12)9(4,14)10(5,15)8(3,13)6-11/h11-15H,6H2,1-5H3/t8-,9+,10+/m0/s1 |
| InChIKey | YNWGIYBRIPKRJK-IVZWLZJFSA-N |
| XLogP | -1.00 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |