C40H59ClN2O8 — CID 3409256
2-chloroethyl N-[15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate (PubChem CID 3409256) has the molecular formula C40H59ClN2O8 and a molecular weight of 731.37 g/mol. Its IUPAC name is 2-chloroethyl N-[15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate.
| Compound Name | 2-chloroethyl N-[15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate |
|---|---|
| PubChem CID | 3409256 |
| Molecular Formula | C40H59ClN2O8 |
| Molecular Weight | 731.37 g/mol |
| Exact Mass | 730.40 |
| IUPAC Name | 2-chloroethyl N-[15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate |
| SMILES | C=CCOc1ccc2c(c1)C1C(CCCCO)C(CCCCO)C=C3C(=NOC(C)(C)C)CC(N(CCC)C(=O)OCCCl)C(OCC=C)(O2)C31 |
| InChI | InChI=1S/C40H59ClN2O8/c1-7-19-43(38(46)48-24-18-41)35-27-33(42-51-39(4,5)6)31-25-28(14-10-12-20-44)30(15-11-13-21-45)36-32-26-29(47-22-8-2)16-17-34(32)50-40(35,37(31)36)49-23-9-3/h8-9,16-17,25-26,28,30,35-37,44-45H,2-3,7,10-15,18-24,27H2,1,4-6H3 |
| InChIKey | USCXRBNFPRFKBX-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.37 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|