C14H10O9 — CID 341
3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoic acid (PubChem CID 341) has the molecular formula C14H10O9 and a molecular weight of 322.23 g/mol. Its IUPAC name is 3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoic acid.
| Compound Name | 3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoic acid |
|---|---|
| PubChem CID | 341 |
| Molecular Formula | C14H10O9 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoic acid |
| SMILES | O=C(O)c1cc(O)c(O)c(OC(=O)c2cc(O)c(O)c(O)c2)c1 |
| InChI | InChI=1S/C14H10O9/c15-7-2-6(3-8(16)11(7)18)14(22)23-10-4-5(13(20)21)1-9(17)12(10)19/h1-4,15-19H,(H,20,21) |
| InChIKey | COVFEVWNJUOYRL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|