C31H33N3O3 — CID 3410555
7-[3-(3,3-dimethylpiperidin-1-yl)propylamino]-2-methyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione (PubChem CID 3410555) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 7-[3-(3,3-dimethylpiperidin-1-yl)propylamino]-2-methyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione.
| Compound Name | 7-[3-(3,3-dimethylpiperidin-1-yl)propylamino]-2-methyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione |
|---|---|
| PubChem CID | 3410555 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 7-[3-(3,3-dimethylpiperidin-1-yl)propylamino]-2-methyl-14H-naphtho[3,2-a]phenoxazine-8,13-dione |
| SMILES | Cc1ccc2oc3cc(NCCCN4CCCC(C)(C)C4)c4c(=O)c5ccccc5c(=O)c4c3[nH]c2c1 |
| InChI | InChI=1S/C31H33N3O3/c1-19-10-11-24-22(16-19)33-28-25(37-24)17-23(32-13-7-15-34-14-6-12-31(2,3)18-34)26-27(28)30(36)21-9-5-4-8-20(21)29(26)35/h4-5,8-11,16-17,32-33H,6-7,12-15,18H2,1-3H3 |
| InChIKey | NBCSBAYIBNSAKD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|