C29H38N2O2 — CID 3411231
(4-benzylpiperidin-1-yl)-[1-(4-tert-butylbenzoyl)piperidin-4-yl]methanone (PubChem CID 3411231) has the molecular formula C29H38N2O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[1-(4-tert-butylbenzoyl)piperidin-4-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[1-(4-tert-butylbenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 3411231 |
| Molecular Formula | C29H38N2O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[1-(4-tert-butylbenzoyl)piperidin-4-yl]methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCC(C(=O)N3CCC(Cc4ccccc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H38N2O2/c1-29(2,3)26-11-9-24(10-12-26)27(32)31-19-15-25(16-20-31)28(33)30-17-13-23(14-18-30)21-22-7-5-4-6-8-22/h4-12,23,25H,13-21H2,1-3H3 |
| InChIKey | SDHKXZGXEAOKEO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |