C25H33F2N3OS — CID 3411263
3-(3,5-difluorophenyl)-1-(3-ethoxypropyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea (PubChem CID 3411263) has the molecular formula C25H33F2N3OS and a molecular weight of 461.62 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-1-(3-ethoxypropyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea.
| Compound Name | 3-(3,5-difluorophenyl)-1-(3-ethoxypropyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3411263 |
| Molecular Formula | C25H33F2N3OS |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-(3,5-difluorophenyl)-1-(3-ethoxypropyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
| SMILES | CCCN1CCCc2cc(CN(CCCOCC)C(=S)Nc3cc(F)cc(F)c3)ccc21 |
| InChI | InChI=1S/C25H33F2N3OS/c1-3-10-29-11-5-7-20-14-19(8-9-24(20)29)18-30(12-6-13-31-4-2)25(32)28-23-16-21(26)15-22(27)17-23/h8-9,14-17H,3-7,10-13,18H2,1-2H3,(H,28,32) |
| InChIKey | WMXJFPWKDLPWHA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|