C20H22N3O5P — CID 34116829
N-[(S)-dimethoxyphosphoryl-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylbenzamide (PubChem CID 34116829) has the molecular formula C20H22N3O5P and a molecular weight of 415.39 g/mol. Its IUPAC name is N-[(S)-dimethoxyphosphoryl-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylbenzamide.
| Compound Name | N-[(S)-dimethoxyphosphoryl-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 34116829 |
| Molecular Formula | C20H22N3O5P |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[(S)-dimethoxyphosphoryl-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methylbenzamide |
| SMILES | COP(=O)(OC)[C@H](NC(=O)c1ccc(C)cc1)c1nnc(-c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C20H22N3O5P/c1-13-5-9-15(10-6-13)17(24)21-20(29(25,26-3)27-4)19-23-22-18(28-19)16-11-7-14(2)8-12-16/h5-12,20H,1-4H3,(H,21,24)/t20-/m0/s1 |
| InChIKey | FINALWMCESGHNL-FQEVSTJZSA-N |
| XLogP | 4.27 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|