C14H17NO2 — CID 3412322
2-[furan-2-ylmethyl(methyl)amino]-1-phenylethanol (PubChem CID 3412322) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-[furan-2-ylmethyl(methyl)amino]-1-phenylethanol.
| Compound Name | 2-[furan-2-ylmethyl(methyl)amino]-1-phenylethanol |
|---|---|
| PubChem CID | 3412322 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-[furan-2-ylmethyl(methyl)amino]-1-phenylethanol |
| SMILES | CN(Cc1ccco1)CC(O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO2/c1-15(10-13-8-5-9-17-13)11-14(16)12-6-3-2-4-7-12/h2-9,14,16H,10-11H2,1H3 |
| InChIKey | DKHBYFMJLBDQPJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |