About 1-butyl-3,1-benzoxazine-2,4-dione
1-butyl-3,1-benzoxazine-2,4-dione (PubChem CID 3412750) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-butyl-3,1-benzoxazine-2,4-dione.
Molecular Properties
| Compound Name | 1-butyl-3,1-benzoxazine-2,4-dione |
| PubChem CID | 3412750 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-butyl-3,1-benzoxazine-2,4-dione |
| SMILES | CCCCn1c(=O)oc(=O)c2ccccc21 |
| InChI | InChI=1S/C12H13NO3/c1-2-3-8-13-10-7-5-4-6-9(10)11(14)16-12(13)15/h4-7H,2-3,8H2,1H3 |
| InChIKey | GNXNHIFZVKBXAK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-3,1-benzoxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3,1-benzoxazine-2,4-dione?
The IUPAC name of 1-butyl-3,1-benzoxazine-2,4-dione (CID 3412750) is 1-butyl-3,1-benzoxazine-2,4-dione.
What is the SMILES notation for 1-butyl-3,1-benzoxazine-2,4-dione?
The canonical SMILES for 1-butyl-3,1-benzoxazine-2,4-dione is CCCCn1c(=O)oc(=O)c2ccccc21.
What is the InChIKey of 1-butyl-3,1-benzoxazine-2,4-dione?
The InChIKey is GNXNHIFZVKBXAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-2-3-8-13-10-7-5-4-6-9(10)11(14)16-12(13)15/h4-7H,2-3,8H2,1H3.
What are the key properties of 1-butyl-3,1-benzoxazine-2,4-dione?
1-butyl-3,1-benzoxazine-2,4-dione has a molecular weight of 219.24 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3,1-benzoxazine-2,4-dione is sourced from PubChem (CID 3412750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).