C21H22N4O3 — CID 3413199
3-propyl-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-b]quinoxaline (PubChem CID 3413199) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-propyl-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-b]quinoxaline.
| Compound Name | 3-propyl-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 3413199 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-propyl-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-b]quinoxaline |
| SMILES | CCCn1c(-c2cc(OC)c(OC)c(OC)c2)nc2nc3ccccc3nc21 |
| InChI | InChI=1S/C21H22N4O3/c1-5-10-25-20(13-11-16(26-2)18(28-4)17(12-13)27-3)24-19-21(25)23-15-9-7-6-8-14(15)22-19/h6-9,11-12H,5,10H2,1-4H3 |
| InChIKey | ITLQHTRSORSTDK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |