C37H47ClFN3O3 — CID 3413428
2-(2-chloro-6-fluorophenyl)-1-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone (PubChem CID 3413428) has the molecular formula C37H47ClFN3O3 and a molecular weight of 636.25 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
|---|---|
| PubChem CID | 3413428 |
| Molecular Formula | C37H47ClFN3O3 |
| Molecular Weight | 636.25 g/mol |
| Exact Mass | 635.33 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN1CCCN2CCCN=C21 |
| InChI | InChI=1S/C37H47ClFN3O3/c1-33-11-8-24(43)21-35(33)14-15-37(26(22-35)29(44)20-25-27(38)6-3-7-28(25)39)30(33)9-12-34(2)31(37)10-13-36(34,45)23-42-19-5-18-41-17-4-16-40-32(41)42/h3,6-7,14-15,22,24,30-31,43,45H,4-5,8-13,16-21,23H2,1-2H3 |
| InChIKey | SGRIOOAYCYPDAE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.25 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|