About (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone
(8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone (PubChem CID 3413463) has the molecular formula C15H17N3O2
and a molecular weight of 271.32 g/mol. Its IUPAC name is (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone |
| PubChem CID | 3413463 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone |
| SMILES | Cc1c(C(=O)N2CCCC2)oc2c1-c1[nH]ncc1CC2 |
| InChI | InChI=1S/C15H17N3O2/c1-9-12-11(5-4-10-8-16-17-13(10)12)20-14(9)15(19)18-6-2-3-7-18/h8H,2-7H2,1H3,(H,16,17) |
| InChIKey | WLOZQAGIDQYAQF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone?
The IUPAC name of (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone (CID 3413463) is (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone.
What is the SMILES notation for (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone?
The canonical SMILES for (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone is Cc1c(C(=O)N2CCCC2)oc2c1-c1[nH]ncc1CC2.
What is the InChIKey of (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone?
The InChIKey is WLOZQAGIDQYAQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-9-12-11(5-4-10-8-16-17-13(10)12)20-14(9)15(19)18-6-2-3-7-18/h8H,2-7H2,1H3,(H,16,17).
What are the key properties of (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone?
(8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone has a molecular weight of 271.32 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-4,5-dihydro-1H-furo[2,3-g]indazol-7-yl)-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 3413463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).