C9H9BrN2S — CID 3413695
6-bromo-4-ethyl-1,3-benzothiazol-2-amine (PubChem CID 3413695) has the molecular formula C9H9BrN2S and a molecular weight of 257.16 g/mol. Its IUPAC name is 6-bromo-4-ethyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-4-ethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 3413695 |
| Molecular Formula | C9H9BrN2S |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 6-bromo-4-ethyl-1,3-benzothiazol-2-amine |
| SMILES | CCc1cc(Br)cc2sc(N)nc12 |
| InChI | InChI=1S/C9H9BrN2S/c1-2-5-3-6(10)4-7-8(5)12-9(11)13-7/h3-4H,2H2,1H3,(H2,11,12) |
| InChIKey | RLRFPJSDSWJTIX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |