About N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide
N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide (PubChem CID 3413998) has the molecular formula C17H26N2O3S2
and a molecular weight of 370.54 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide |
| PubChem CID | 3413998 |
| Molecular Formula | C17H26N2O3S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide |
| SMILES | CN(C(=S)NC(=O)C12CC3CC(CC(C3)C1)C2)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N2O3S2/c1-19(14-2-3-24(21,22)10-14)16(23)18-15(20)17-7-11-4-12(8-17)6-13(5-11)9-17/h11-14H,2-10H2,1H3,(H,18,20,23) |
| InChIKey | IJMVHQIPWVWNLD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide?
The IUPAC name of N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide (CID 3413998) is N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide.
What is the SMILES notation for N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide?
The canonical SMILES for N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide is CN(C(=S)NC(=O)C12CC3CC(CC(C3)C1)C2)C1CCS(=O)(=O)C1.
What is the InChIKey of N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide?
The InChIKey is IJMVHQIPWVWNLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O3S2/c1-19(14-2-3-24(21,22)10-14)16(23)18-15(20)17-7-11-4-12(8-17)6-13(5-11)9-17/h11-14H,2-10H2,1H3,(H,18,20,23).
What are the key properties of N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide?
N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide has a molecular weight of 370.54 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,1-dioxothiolan-3-yl)-methylcarbamothioyl]adamantane-1-carboxamide is sourced from PubChem (CID 3413998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).