C28H24N2O7S — CID 3414555
5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 3414555) has the molecular formula C28H24N2O7S and a molecular weight of 532.57 g/mol. Its IUPAC name is 5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3414555 |
| Molecular Formula | C28H24N2O7S |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2C(=C(O)c3ccc(OC)cc3)C(=O)C(=O)N2c2nc3ccc(OC)cc3s2)ccc1O |
| InChI | InChI=1S/C28H24N2O7S/c1-4-37-21-13-16(7-12-20(21)31)24-23(25(32)15-5-8-17(35-2)9-6-15)26(33)27(34)30(24)28-29-19-11-10-18(36-3)14-22(19)38-28/h5-14,24,31-32H,4H2,1-3H3 |
| InChIKey | QEARIACDNGPOAB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|