About N-decyl-4-nitrobenzamide
N-decyl-4-nitrobenzamide (PubChem CID 3414942) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is N-decyl-4-nitrobenzamide.
Molecular Properties
| Compound Name | N-decyl-4-nitrobenzamide |
| PubChem CID | 3414942 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-decyl-4-nitrobenzamide |
| SMILES | CCCCCCCCCCNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-2-3-4-5-6-7-8-9-14-18-17(20)15-10-12-16(13-11-15)19(21)22/h10-13H,2-9,14H2,1H3,(H,18,20) |
| InChIKey | ZHJCYIYHOOGPQR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-decyl-4-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decyl-4-nitrobenzamide?
The IUPAC name of N-decyl-4-nitrobenzamide (CID 3414942) is N-decyl-4-nitrobenzamide.
What is the SMILES notation for N-decyl-4-nitrobenzamide?
The canonical SMILES for N-decyl-4-nitrobenzamide is CCCCCCCCCCNC(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of N-decyl-4-nitrobenzamide?
The InChIKey is ZHJCYIYHOOGPQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O3/c1-2-3-4-5-6-7-8-9-14-18-17(20)15-10-12-16(13-11-15)19(21)22/h10-13H,2-9,14H2,1H3,(H,18,20).
What are the key properties of N-decyl-4-nitrobenzamide?
N-decyl-4-nitrobenzamide has a molecular weight of 306.41 g/mol, XLogP of 4.47, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-decyl-4-nitrobenzamide is sourced from PubChem (CID 3414942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).