C33H30N2O5 — CID 3415016
5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(4-methylphenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 3415016) has the molecular formula C33H30N2O5 and a molecular weight of 534.61 g/mol. Its IUPAC name is 5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(4-methylphenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(4-methylphenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3415016 |
| Molecular Formula | C33H30N2O5 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(4-methylphenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2C(=C(O)c3ccc(C)cc3)C(=O)C(=O)N2Cc2cccnc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H30N2O5/c1-3-39-28-18-26(15-16-27(28)40-21-23-8-5-4-6-9-23)30-29(31(36)25-13-11-22(2)12-14-25)32(37)33(38)35(30)20-24-10-7-17-34-19-24/h4-19,30,36H,3,20-21H2,1-2H3 |
| InChIKey | QHYAUOMZLYLNDQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|