C18H19N3O2S2 — CID 3415174
N,N,5-trimethyl-4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 3415174) has the molecular formula C18H19N3O2S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N,N,5-trimethyl-4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N,N,5-trimethyl-4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 3415174 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N,N,5-trimethyl-4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C)sc2[nH]c(=S)n(CCc3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C18H19N3O2S2/c1-11-13-15(25-14(11)17(23)20(2)3)19-18(24)21(16(13)22)10-9-12-7-5-4-6-8-12/h4-8H,9-10H2,1-3H3,(H,19,24) |
| InChIKey | LRVYBVISLXUMSN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|