C18H23N3O2 — CID 3415222
[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]-piperidin-1-ylmethanone (PubChem CID 3415222) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is [1-(1,3-benzoxazol-2-yl)piperidin-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-(1,3-benzoxazol-2-yl)piperidin-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 3415222 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | [1-(1,3-benzoxazol-2-yl)piperidin-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(C1CCN(c2nc3ccccc3o2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C18H23N3O2/c22-17(20-10-4-1-5-11-20)14-8-12-21(13-9-14)18-19-15-6-2-3-7-16(15)23-18/h2-3,6-7,14H,1,4-5,8-13H2 |
| InChIKey | MGYXORVPHANPPB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |