C17H17N3O4S — CID 3415462
N-[4-[cyano-(4-ethoxyphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 3415462) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[4-[cyano-(4-ethoxyphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[cyano-(4-ethoxyphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 3415462 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[4-[cyano-(4-ethoxyphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | CCOc1ccc(N(C#N)S(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C17H17N3O4S/c1-3-24-16-8-6-15(7-9-16)20(12-18)25(22,23)17-10-4-14(5-11-17)19-13(2)21/h4-11H,3H2,1-2H3,(H,19,21) |
| InChIKey | FXBYEZNEDVRKIZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|