C36H36N4S2+2 — CID 3415898
3-[6-(2-anilino-4-phenyl-1,3-thiazol-3-ium-3-yl)hexyl]-N,4-diphenyl-1,3-thiazol-3-ium-2-amine (PubChem CID 3415898) has the molecular formula C36H36N4S2+2 and a molecular weight of 588.85 g/mol. Its IUPAC name is 3-[6-(2-anilino-4-phenyl-1,3-thiazol-3-ium-3-yl)hexyl]-N,4-diphenyl-1,3-thiazol-3-ium-2-amine.
| Compound Name | 3-[6-(2-anilino-4-phenyl-1,3-thiazol-3-ium-3-yl)hexyl]-N,4-diphenyl-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 3415898 |
| Molecular Formula | C36H36N4S2+2 |
| Molecular Weight | 588.85 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | 3-[6-(2-anilino-4-phenyl-1,3-thiazol-3-ium-3-yl)hexyl]-N,4-diphenyl-1,3-thiazol-3-ium-2-amine |
| SMILES | c1ccc(Nc2scc(-c3ccccc3)[n+]2CCCCCC[n+]2c(-c3ccccc3)csc2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C36H34N4S2/c1(15-25-39-33(29-17-7-3-8-18-29)27-41-35(39)37-31-21-11-5-12-22-31)2-16-26-40-34(30-19-9-4-10-20-30)28-42-36(40)38-32-23-13-6-14-24-32/h3-14,17-24,27-28H,1-2,15-16,25-26H2/p+2 |
| InChIKey | BYCMIWUUJSOPGW-UHFFFAOYSA-P |
| XLogP | 9.47 |
| TPSA | 31.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.85 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|