About 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate
2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate (PubChem CID 3416006) has the molecular formula C19H21N5O6
and a molecular weight of 415.41 g/mol. Its IUPAC name is 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate.
Molecular Properties
| Compound Name | 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate |
| PubChem CID | 3416006 |
| Molecular Formula | C19H21N5O6 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCCNC(=O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H21N5O6/c1-22-16-15(17(26)23(2)19(22)28)24(11-21-16)10-14(25)20-8-9-30-18(27)12-6-4-5-7-13(12)29-3/h4-7,11H,8-10H2,1-3H3,(H,20,25) |
| InChIKey | QGWDGSGABFAUQB-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate?
The IUPAC name of 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate (CID 3416006) is 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate.
What is the SMILES notation for 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate?
The canonical SMILES for 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate is COc1ccccc1C(=O)OCCNC(=O)Cn1cnc2c1c(=O)n(C)c(=O)n2C.
What is the InChIKey of 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate?
The InChIKey is QGWDGSGABFAUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O6/c1-22-16-15(17(26)23(2)19(22)28)24(11-21-16)10-14(25)20-8-9-30-18(27)12-6-4-5-7-13(12)29-3/h4-7,11H,8-10H2,1-3H3,(H,20,25).
What are the key properties of 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate?
2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate has a molecular weight of 415.41 g/mol, XLogP of -0.58, 7 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]ethyl 2-methoxybenzoate is sourced from PubChem (CID 3416006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).