C19H31N3O2 — CID 34160293
N-(2-tert-butylphenyl)-2-[[2-(diethylamino)-2-oxoethyl]-methylamino]acetamide (PubChem CID 34160293) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-2-[[2-(diethylamino)-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-(2-tert-butylphenyl)-2-[[2-(diethylamino)-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 34160293 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | N-(2-tert-butylphenyl)-2-[[2-(diethylamino)-2-oxoethyl]-methylamino]acetamide |
| SMILES | CCN(CC)C(=O)CN(C)CC(=O)Nc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C19H31N3O2/c1-7-22(8-2)18(24)14-21(6)13-17(23)20-16-12-10-9-11-15(16)19(3,4)5/h9-12H,7-8,13-14H2,1-6H3,(H,20,23) |
| InChIKey | YEWRHAIVQIZZMT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |