C20H16ClN3O4 — CID 34161619
methyl 2-chloro-5-[(6-methyl-4-oxo-1-phenylpyridazine-3-carbonyl)amino]benzoate (PubChem CID 34161619) has the molecular formula C20H16ClN3O4 and a molecular weight of 397.82 g/mol. Its IUPAC name is methyl 2-chloro-5-[(6-methyl-4-oxo-1-phenylpyridazine-3-carbonyl)amino]benzoate.
| Compound Name | methyl 2-chloro-5-[(6-methyl-4-oxo-1-phenylpyridazine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 34161619 |
| Molecular Formula | C20H16ClN3O4 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | methyl 2-chloro-5-[(6-methyl-4-oxo-1-phenylpyridazine-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2nn(-c3ccccc3)c(C)cc2=O)ccc1Cl |
| InChI | InChI=1S/C20H16ClN3O4/c1-12-10-17(25)18(23-24(12)14-6-4-3-5-7-14)19(26)22-13-8-9-16(21)15(11-13)20(27)28-2/h3-11H,1-2H3,(H,22,26) |
| InChIKey | IYMJXBSMHNCQCJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |