About 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol
2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol (PubChem CID 3416301) has the molecular formula C16H14F3NO
and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol.
Molecular Properties
| Compound Name | 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol |
| PubChem CID | 3416301 |
| Molecular Formula | C16H14F3NO |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol |
| SMILES | OCC(/N=C(\c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H14F3NO/c17-16(18,19)15(13-9-5-2-6-10-13)20-14(11-21)12-7-3-1-4-8-12/h1-10,14,21H,11H2/b20-15+ |
| InChIKey | NNULSLZUCWLDJK-HMMYKYKNSA-N |
| XLogP | 3.77 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol?
The IUPAC name of 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol (CID 3416301) is 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol.
What is the SMILES notation for 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol?
The canonical SMILES for 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol is OCC(/N=C(\c1ccccc1)C(F)(F)F)c1ccccc1.
What is the InChIKey of 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol?
The InChIKey is NNULSLZUCWLDJK-HMMYKYKNSA-N. The full InChI is InChI=1S/C16H14F3NO/c17-16(18,19)15(13-9-5-2-6-10-13)20-14(11-21)12-7-3-1-4-8-12/h1-10,14,21H,11H2/b20-15+.
What are the key properties of 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol?
2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol has a molecular weight of 293.29 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]ethanol is sourced from PubChem (CID 3416301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).