About 2-amino-2-(3,5-dichlorophenyl)acetic acid
2-amino-2-(3,5-dichlorophenyl)acetic acid (PubChem CID 3416310) has the molecular formula C8H7Cl2NO2
and a molecular weight of 220.06 g/mol. Its IUPAC name is 2-amino-2-(3,5-dichlorophenyl)acetic acid.
Molecular Properties
| Compound Name | 2-amino-2-(3,5-dichlorophenyl)acetic acid |
| PubChem CID | 3416310 |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | 2-amino-2-(3,5-dichlorophenyl)acetic acid |
| SMILES | NC(C(=O)O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2NO2/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3,7H,11H2,(H,12,13) |
| InChIKey | GAQVGSJHXPYMCP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-2-(3,5-dichlorophenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(3,5-dichlorophenyl)acetic acid?
The IUPAC name of 2-amino-2-(3,5-dichlorophenyl)acetic acid (CID 3416310) is 2-amino-2-(3,5-dichlorophenyl)acetic acid.
What is the SMILES notation for 2-amino-2-(3,5-dichlorophenyl)acetic acid?
The canonical SMILES for 2-amino-2-(3,5-dichlorophenyl)acetic acid is NC(C(=O)O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-amino-2-(3,5-dichlorophenyl)acetic acid?
The InChIKey is GAQVGSJHXPYMCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2NO2/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3,7H,11H2,(H,12,13).
What are the key properties of 2-amino-2-(3,5-dichlorophenyl)acetic acid?
2-amino-2-(3,5-dichlorophenyl)acetic acid has a molecular weight of 220.06 g/mol, XLogP of 2.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(3,5-dichlorophenyl)acetic acid is sourced from PubChem (CID 3416310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).