C23H29N3O5S — CID 3417083
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3,3-dimethylbutanamide (PubChem CID 3417083) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3,3-dimethylbutanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 3417083 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3,3-dimethylbutanamide |
| SMILES | COc1ccc(CCNC(=O)CC(C)(C)CC2=NS(=O)(=O)c3ccccc3N2)cc1OC |
| InChI | InChI=1S/C23H29N3O5S/c1-23(2,14-21-25-17-7-5-6-8-20(17)32(28,29)26-21)15-22(27)24-12-11-16-9-10-18(30-3)19(13-16)31-4/h5-10,13H,11-12,14-15H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | XSLCKAAESJZOSA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |