C27H26N2O — CID 3417174
N-(2,6-diethylphenyl)-3-methyl-2-phenylquinoline-4-carboxamide (PubChem CID 3417174) has the molecular formula C27H26N2O and a molecular weight of 394.52 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-3-methyl-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-3-methyl-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3417174 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-(2,6-diethylphenyl)-3-methyl-2-phenylquinoline-4-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1c(C)c(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C27H26N2O/c1-4-19-14-11-15-20(5-2)26(19)29-27(30)24-18(3)25(21-12-7-6-8-13-21)28-23-17-10-9-16-22(23)24/h6-17H,4-5H2,1-3H3,(H,29,30) |
| InChIKey | UOIJUHRQSHSWAO-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |