About [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea
[[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea (PubChem CID 3417214) has the molecular formula C15H25N3O2
and a molecular weight of 279.38 g/mol. Its IUPAC name is [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea.
Molecular Properties
| Compound Name | [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea |
| PubChem CID | 3417214 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea |
| SMILES | CC12CC3CC(C)(C1)CC(CC(=O)NNC(N)=O)(C3)C2 |
| InChI | InChI=1S/C15H25N3O2/c1-13-3-10-4-14(2,7-13)9-15(5-10,8-13)6-11(19)17-18-12(16)20/h10H,3-9H2,1-2H3,(H,17,19)(H3,16,18,20) |
| InChIKey | VWQWZWQMBOAJIZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea?
The IUPAC name of [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea (CID 3417214) is [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea.
What is the SMILES notation for [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea?
The canonical SMILES for [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea is CC12CC3CC(C)(C1)CC(CC(=O)NNC(N)=O)(C3)C2.
What is the InChIKey of [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea?
The InChIKey is VWQWZWQMBOAJIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2/c1-13-3-10-4-14(2,7-13)9-15(5-10,8-13)6-11(19)17-18-12(16)20/h10H,3-9H2,1-2H3,(H,17,19)(H3,16,18,20).
What are the key properties of [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea?
[[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea has a molecular weight of 279.38 g/mol, XLogP of 2.07, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(3,5-dimethyl-1-adamantyl)acetyl]amino]urea is sourced from PubChem (CID 3417214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).