C10H20N2O5 — CID 34175663
(2R)-3-(2-hydroxyethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 34175663) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is (2R)-3-(2-hydroxyethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2R)-3-(2-hydroxyethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 34175663 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2R)-3-(2-hydroxyethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CNCCO)C(=O)O |
| InChI | InChI=1S/C10H20N2O5/c1-10(2,3)17-9(16)12-7(8(14)15)6-11-4-5-13/h7,11,13H,4-6H2,1-3H3,(H,12,16)(H,14,15)/t7-/m1/s1 |
| InChIKey | RYICQTAAATZOID-SSDOTTSWSA-N |
| XLogP | -0.45 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|