C17H25NO4S — CID 3417661
3-butyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazinan-4-one (PubChem CID 3417661) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 3-butyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazinan-4-one.
| Compound Name | 3-butyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 3417661 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-butyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazinan-4-one |
| SMILES | CCCCN1C(=O)CCSC1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H25NO4S/c1-5-6-8-18-15(19)7-9-23-17(18)12-10-13(20-2)16(22-4)14(11-12)21-3/h10-11,17H,5-9H2,1-4H3 |
| InChIKey | NVRGIOCWFCKBLX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |