C13H11N5O5 — CID 3417730
N-[2-[2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]pyridine-3-carboxamide (PubChem CID 3417730) has the molecular formula C13H11N5O5 and a molecular weight of 317.26 g/mol. Its IUPAC name is N-[2-[2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3417730 |
| Molecular Formula | C13H11N5O5 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-[2-[2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]pyridine-3-carboxamide |
| SMILES | O=C(CNC(=O)c1cccnc1)NN=Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H11N5O5/c19-11(8-15-13(20)9-2-1-5-14-6-9)17-16-7-10-3-4-12(23-10)18(21)22/h1-7H,8H2,(H,15,20)(H,17,19) |
| InChIKey | BTOSTLUZEJFTLR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 139.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|