About 3,4-diethylisoquinoline
3,4-diethylisoquinoline (PubChem CID 34177997) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 3,4-diethylisoquinoline.
Molecular Properties
| Compound Name | 3,4-diethylisoquinoline |
| PubChem CID | 34177997 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3,4-diethylisoquinoline |
| SMILES | CCc1ncc2ccccc2c1CC |
| InChI | InChI=1S/C13H15N/c1-3-11-12-8-6-5-7-10(12)9-14-13(11)4-2/h5-9H,3-4H2,1-2H3 |
| InChIKey | CVADSWZBULGWCN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-diethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethylisoquinoline?
The IUPAC name of 3,4-diethylisoquinoline (CID 34177997) is 3,4-diethylisoquinoline.
What is the SMILES notation for 3,4-diethylisoquinoline?
The canonical SMILES for 3,4-diethylisoquinoline is CCc1ncc2ccccc2c1CC.
What is the InChIKey of 3,4-diethylisoquinoline?
The InChIKey is CVADSWZBULGWCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-3-11-12-8-6-5-7-10(12)9-14-13(11)4-2/h5-9H,3-4H2,1-2H3.
What are the key properties of 3,4-diethylisoquinoline?
3,4-diethylisoquinoline has a molecular weight of 185.27 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethylisoquinoline is sourced from PubChem (CID 34177997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).