About pyrrole-1-carboxylic acid
pyrrole-1-carboxylic acid (PubChem CID 3417815) has the molecular formula C5H5NO2
and a molecular weight of 111.10 g/mol. Its IUPAC name is pyrrole-1-carboxylic acid.
Molecular Properties
| Compound Name | pyrrole-1-carboxylic acid |
| PubChem CID | 3417815 |
| Molecular Formula | C5H5NO2 |
| Molecular Weight | 111.10 g/mol |
| Exact Mass | 111.03 |
| IUPAC Name | pyrrole-1-carboxylic acid |
| SMILES | O=C(O)n1cccc1 |
| InChI | InChI=1S/C5H5NO2/c7-5(8)6-3-1-2-4-6/h1-4H,(H,7,8) |
| InChIKey | FDDQRDMHICUGQC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.10 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrole-1-carboxylic acid?
The IUPAC name of pyrrole-1-carboxylic acid (CID 3417815) is pyrrole-1-carboxylic acid.
What is the SMILES notation for pyrrole-1-carboxylic acid?
The canonical SMILES for pyrrole-1-carboxylic acid is O=C(O)n1cccc1.
What is the InChIKey of pyrrole-1-carboxylic acid?
The InChIKey is FDDQRDMHICUGQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2/c7-5(8)6-3-1-2-4-6/h1-4H,(H,7,8).
What are the key properties of pyrrole-1-carboxylic acid?
pyrrole-1-carboxylic acid has a molecular weight of 111.10 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrole-1-carboxylic acid is sourced from PubChem (CID 3417815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).