About 4-chloro-5,6,7,8-tetrafluoroquinazoline
4-chloro-5,6,7,8-tetrafluoroquinazoline (PubChem CID 34179176) has the molecular formula C8HClF4N2
and a molecular weight of 236.56 g/mol. Its IUPAC name is 4-chloro-5,6,7,8-tetrafluoroquinazoline.
Molecular Properties
| Compound Name | 4-chloro-5,6,7,8-tetrafluoroquinazoline |
| PubChem CID | 34179176 |
| Molecular Formula | C8HClF4N2 |
| Molecular Weight | 236.56 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 4-chloro-5,6,7,8-tetrafluoroquinazoline |
| SMILES | Fc1c(F)c(F)c2c(Cl)ncnc2c1F |
| InChI | InChI=1S/C8HClF4N2/c9-8-2-3(10)4(11)5(12)6(13)7(2)14-1-15-8/h1H |
| InChIKey | QBXLZCMKEQJLPY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5,6,7,8-tetrafluoroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5,6,7,8-tetrafluoroquinazoline?
The IUPAC name of 4-chloro-5,6,7,8-tetrafluoroquinazoline (CID 34179176) is 4-chloro-5,6,7,8-tetrafluoroquinazoline.
What is the SMILES notation for 4-chloro-5,6,7,8-tetrafluoroquinazoline?
The canonical SMILES for 4-chloro-5,6,7,8-tetrafluoroquinazoline is Fc1c(F)c(F)c2c(Cl)ncnc2c1F.
What is the InChIKey of 4-chloro-5,6,7,8-tetrafluoroquinazoline?
The InChIKey is QBXLZCMKEQJLPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8HClF4N2/c9-8-2-3(10)4(11)5(12)6(13)7(2)14-1-15-8/h1H.
What are the key properties of 4-chloro-5,6,7,8-tetrafluoroquinazoline?
4-chloro-5,6,7,8-tetrafluoroquinazoline has a molecular weight of 236.56 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5,6,7,8-tetrafluoroquinazoline is sourced from PubChem (CID 34179176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).