C12H16O2 — CID 34179452
(7R)-2,2,7-trimethyl-7,8-dihydro-6H-chromen-5-one (PubChem CID 34179452) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (7R)-2,2,7-trimethyl-7,8-dihydro-6H-chromen-5-one.
| Compound Name | (7R)-2,2,7-trimethyl-7,8-dihydro-6H-chromen-5-one |
|---|---|
| PubChem CID | 34179452 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (7R)-2,2,7-trimethyl-7,8-dihydro-6H-chromen-5-one |
| SMILES | C[C@H]1CC(=O)C2=C(C1)OC(C)(C)C=C2 |
| InChI | InChI=1S/C12H16O2/c1-8-6-10(13)9-4-5-12(2,3)14-11(9)7-8/h4-5,8H,6-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | QGPRNWZHXLFVBS-QMMMGPOBSA-N |
| XLogP | 2.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |