(3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid

C16H17NO2S — CID 34180143

IUPAC(3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid
SMILESO=C(O)[C@H]1CN(Cc2ccccc2)C[C@@H]1c1cccs1
InChIInChI=1S/C16H17NO2S/c18-16(19)14-11-17(9-12-5-2-1-3-6-12)10-13(14)15-7-4-8-20-15/h1-8,13-14H,9-11H2,(H,18,19)/t13-,14-/m0/s1
InChIKeyWKOQJWXJELLGLA-KBPBESRZSA-N
MW287.38 g/mol
LogP3.05
Rot. Bonds4

About (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid

(3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid (PubChem CID 34180143) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name(3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid
PubChem CID34180143
Molecular FormulaC16H17NO2S
Molecular Weight287.38 g/mol
Exact Mass287.10
IUPAC Name(3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid
SMILESO=C(O)[C@H]1CN(Cc2ccccc2)C[C@@H]1c1cccs1
InChIInChI=1S/C16H17NO2S/c18-16(19)14-11-17(9-12-5-2-1-3-6-12)10-13(14)15-7-4-8-20-15/h1-8,13-14H,9-11H2,(H,18,19)/t13-,14-/m0/s1
InChIKeyWKOQJWXJELLGLA-KBPBESRZSA-N
XLogP3.05
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.38
LogP ≤ 53.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid?
The IUPAC name of (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid (CID 34180143) is (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid?
The canonical SMILES for (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid is O=C(O)[C@H]1CN(Cc2ccccc2)C[C@@H]1c1cccs1.
What is the InChIKey of (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid?
The InChIKey is WKOQJWXJELLGLA-KBPBESRZSA-N. The full InChI is InChI=1S/C16H17NO2S/c18-16(19)14-11-17(9-12-5-2-1-3-6-12)10-13(14)15-7-4-8-20-15/h1-8,13-14H,9-11H2,(H,18,19)/t13-,14-/m0/s1.
What are the key properties of (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid?
(3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid has a molecular weight of 287.38 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-1-benzyl-4-thiophen-2-ylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 34180143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).