About nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol)
nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol) (PubChem CID 3418088) has the molecular formula C26H22N6NiO6
and a molecular weight of 573.19 g/mol. Its IUPAC name is nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol).
Molecular Properties
| Compound Name | nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol) |
| PubChem CID | 3418088 |
| Molecular Formula | C26H22N6NiO6 |
| Molecular Weight | 573.19 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol) |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/Cc2ccccn2)c1.O=[N+]([O-])c1ccc(O)c(C=NCc2ccccn2)c1.[Ni] |
| InChI | InChI=1S/2C13H11N3O3.Ni/c2*17-13-5-4-12(16(18)19)7-10(13)8-14-9-11-3-1-2-6-15-11;/h2*1-8,17H,9H2;/b14-8+;; |
| InChIKey | GLWKBUYRSCAMCE-JPMXUBAOSA-N |
| XLogP | 4.63 |
| TPSA | 177.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 573.19 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol)?
The IUPAC name of nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol) (CID 3418088) is nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol).
What is the SMILES notation for nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol)?
The canonical SMILES for nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol) is O=[N+]([O-])c1ccc(O)c(/C=N/Cc2ccccn2)c1.O=[N+]([O-])c1ccc(O)c(C=NCc2ccccn2)c1.[Ni].
What is the InChIKey of nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol)?
The InChIKey is GLWKBUYRSCAMCE-JPMXUBAOSA-N. The full InChI is InChI=1S/2C13H11N3O3.Ni/c2*17-13-5-4-12(16(18)19)7-10(13)8-14-9-11-3-1-2-6-15-11;/h2*1-8,17H,9H2;/b14-8+;;.
What are the key properties of nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol)?
nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol) has a molecular weight of 573.19 g/mol, XLogP of 4.63, 8 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;bis(4-nitro-2-(pyridin-2-ylmethyliminomethyl)phenol) is sourced from PubChem (CID 3418088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).