About [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate
[4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate (PubChem CID 3418130) has the molecular formula C18H28N2O9S
and a molecular weight of 448.49 g/mol. Its IUPAC name is [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate.
Molecular Properties
| Compound Name | [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate |
| PubChem CID | 3418130 |
| Molecular Formula | C18H28N2O9S |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(O)C1SCC(C(=O)N(C)C)N1C(C)=O |
| InChI | InChI=1S/C18H28N2O9S/c1-9(21)20-13(17(26)19(5)6)8-30-18(20)15(25)16(29-12(4)24)14(28-11(3)23)7-27-10(2)22/h13-16,18,25H,7-8H2,1-6H3 |
| InChIKey | SUWBETGVJGEAJL-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate?
The IUPAC name of [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate (CID 3418130) is [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate.
What is the SMILES notation for [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate?
The canonical SMILES for [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate is CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(O)C1SCC(C(=O)N(C)C)N1C(C)=O.
What is the InChIKey of [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate?
The InChIKey is SUWBETGVJGEAJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O9S/c1-9(21)20-13(17(26)19(5)6)8-30-18(20)15(25)16(29-12(4)24)14(28-11(3)23)7-27-10(2)22/h13-16,18,25H,7-8H2,1-6H3.
What are the key properties of [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate?
[4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate has a molecular weight of 448.49 g/mol, XLogP of -0.85, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate is sourced from PubChem (CID 3418130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).