About [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol
[(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol (PubChem CID 34181472) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol |
| PubChem CID | 34181472 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol |
| SMILES | N[C@H]1CCN(Cc2ccccc2)C[C@@H]1CO |
| InChI | InChI=1S/C13H20N2O/c14-13-6-7-15(9-12(13)10-16)8-11-4-2-1-3-5-11/h1-5,12-13,16H,6-10,14H2/t12-,13+/m1/s1 |
| InChIKey | CZCYWYTZXZUBOO-OLZOCXBDSA-N |
| XLogP | 0.83 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol?
The IUPAC name of [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol (CID 34181472) is [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol.
What is the SMILES notation for [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol?
The canonical SMILES for [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol is N[C@H]1CCN(Cc2ccccc2)C[C@@H]1CO.
What is the InChIKey of [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol?
The InChIKey is CZCYWYTZXZUBOO-OLZOCXBDSA-N. The full InChI is InChI=1S/C13H20N2O/c14-13-6-7-15(9-12(13)10-16)8-11-4-2-1-3-5-11/h1-5,12-13,16H,6-10,14H2/t12-,13+/m1/s1.
What are the key properties of [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol?
[(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol has a molecular weight of 220.32 g/mol, XLogP of 0.83, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-4-amino-1-benzylpiperidin-3-yl]methanol is sourced from PubChem (CID 34181472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).