C17H17N3O2 — CID 3418247
2,5-dimethyl-4-(4-phenylmethoxyphenyl)-1,2,4-triazol-3-one (PubChem CID 3418247) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2,5-dimethyl-4-(4-phenylmethoxyphenyl)-1,2,4-triazol-3-one.
| Compound Name | 2,5-dimethyl-4-(4-phenylmethoxyphenyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 3418247 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2,5-dimethyl-4-(4-phenylmethoxyphenyl)-1,2,4-triazol-3-one |
| SMILES | Cc1nn(C)c(=O)n1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17N3O2/c1-13-18-19(2)17(21)20(13)15-8-10-16(11-9-15)22-12-14-6-4-3-5-7-14/h3-11H,12H2,1-2H3 |
| InChIKey | HZILGUIBBYRZFZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |