C25H24N2OS — CID 3418559
9-(4-methylphenyl)-6-(5-methylthiophen-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 3418559) has the molecular formula C25H24N2OS and a molecular weight of 400.55 g/mol. Its IUPAC name is 9-(4-methylphenyl)-6-(5-methylthiophen-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(4-methylphenyl)-6-(5-methylthiophen-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 3418559 |
| Molecular Formula | C25H24N2OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 9-(4-methylphenyl)-6-(5-methylthiophen-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2ccc(C)s2)cc1 |
| InChI | InChI=1S/C25H24N2OS/c1-15-7-10-17(11-8-15)18-13-21-24(22(28)14-18)25(23-12-9-16(2)29-23)27-20-6-4-3-5-19(20)26-21/h3-12,18,25-27H,13-14H2,1-2H3 |
| InChIKey | DBWYZMNKKHXKKY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |