C30H32N2O6 — CID 3419157
6-(3-ethoxy-4-hydroxyphenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 3419157) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is 6-(3-ethoxy-4-hydroxyphenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(3-ethoxy-4-hydroxyphenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 3419157 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 6-(3-ethoxy-4-hydroxyphenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCOc1cc(C2Nc3ccccc3NC3=C2C(=O)CC(c2cc(OC)c(OC)c(OC)c2)C3)ccc1O |
| InChI | InChI=1S/C30H32N2O6/c1-5-38-25-14-17(10-11-23(25)33)29-28-22(31-20-8-6-7-9-21(20)32-29)12-18(13-24(28)34)19-15-26(35-2)30(37-4)27(16-19)36-3/h6-11,14-16,18,29,31-33H,5,12-13H2,1-4H3 |
| InChIKey | NPFSRCMXDREDAL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |