C6H12N4 — CID 3419382
N,N,3,5-tetramethyl-1,2,4-triazol-4-amine (PubChem CID 3419382) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is N,N,3,5-tetramethyl-1,2,4-triazol-4-amine.
| Compound Name | N,N,3,5-tetramethyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 3419382 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | N,N,3,5-tetramethyl-1,2,4-triazol-4-amine |
| SMILES | Cc1nnc(C)n1N(C)C |
| InChI | InChI=1S/C6H12N4/c1-5-7-8-6(2)10(5)9(3)4/h1-4H3 |
| InChIKey | QBXVKKLKAHBQPM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |