About N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide
N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide (PubChem CID 3419437) has the molecular formula C26H32N2O4
and a molecular weight of 436.55 g/mol. Its IUPAC name is N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide.
Molecular Properties
| Compound Name | N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide |
| PubChem CID | 3419437 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide |
| SMILES | CCCCCCCCCC(=O)N(CN1C(=O)c2ccccc2C1=O)c1ccccc1OC |
| InChI | InChI=1S/C26H32N2O4/c1-3-4-5-6-7-8-9-18-24(29)27(22-16-12-13-17-23(22)32-2)19-28-25(30)20-14-10-11-15-21(20)26(28)31/h10-17H,3-9,18-19H2,1-2H3 |
| InChIKey | FYDAQJBKGXKXRP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide?
The IUPAC name of N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide (CID 3419437) is N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide.
What is the SMILES notation for N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide?
The canonical SMILES for N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide is CCCCCCCCCC(=O)N(CN1C(=O)c2ccccc2C1=O)c1ccccc1OC.
What is the InChIKey of N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide?
The InChIKey is FYDAQJBKGXKXRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O4/c1-3-4-5-6-7-8-9-18-24(29)27(22-16-12-13-17-23(22)32-2)19-28-25(30)20-14-10-11-15-21(20)26(28)31/h10-17H,3-9,18-19H2,1-2H3.
What are the key properties of N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide?
N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide has a molecular weight of 436.55 g/mol, XLogP of 5.42, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-methoxyphenyl)decanamide is sourced from PubChem (CID 3419437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).