C21H21N3O2 — CID 3419590
7-(4-methylphenyl)-4-phenyl-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione (PubChem CID 3419590) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 7-(4-methylphenyl)-4-phenyl-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione.
| Compound Name | 7-(4-methylphenyl)-4-phenyl-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 3419590 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 7-(4-methylphenyl)-4-phenyl-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
| SMILES | Cc1ccc(C2C3C(=O)N(c4ccccc4)C(=O)C3N3CCCN23)cc1 |
| InChI | InChI=1S/C21H21N3O2/c1-14-8-10-15(11-9-14)18-17-19(23-13-5-12-22(18)23)21(26)24(20(17)25)16-6-3-2-4-7-16/h2-4,6-11,17-19H,5,12-13H2,1H3 |
| InChIKey | SXLSPJJOHGYJAS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|